C19H26N4O3S — CID 89381016
2-amino-N-[(2R)-3-(1-benzothiophen-3-yl)-1-[formamidomethyl(methyl)amino]-1-oxopropan-2-yl]-N,2-dimethylpropanamide (PubChem CID 89381016) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is 2-amino-N-[(2R)-3-(1-benzothiophen-3-yl)-1-[formamidomethyl(methyl)amino]-1-oxopropan-2-yl]-N,2-dimethylpropanamide.
| Compound Name | 2-amino-N-[(2R)-3-(1-benzothiophen-3-yl)-1-[formamidomethyl(methyl)amino]-1-oxopropan-2-yl]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 89381016 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2-amino-N-[(2R)-3-(1-benzothiophen-3-yl)-1-[formamidomethyl(methyl)amino]-1-oxopropan-2-yl]-N,2-dimethylpropanamide |
| SMILES | CN(CNC=O)C(=O)[C@@H](Cc1csc2ccccc12)N(C)C(=O)C(C)(C)N |
| InChI | InChI=1S/C19H26N4O3S/c1-19(2,20)18(26)23(4)15(17(25)22(3)11-21-12-24)9-13-10-27-16-8-6-5-7-14(13)16/h5-8,10,12,15H,9,11,20H2,1-4H3,(H,21,24)/t15-/m1/s1 |
| InChIKey | VXGHGUVEUJRBIR-OAHLLOKOSA-N |
| XLogP | 1.17 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|