C8H16O — CID 89381426
(Z,2S)-2-ethylhex-4-en-1-ol (PubChem CID 89381426) has the molecular formula C8H16O and a molecular weight of 128.21 g/mol. Its IUPAC name is (Z,2S)-2-ethylhex-4-en-1-ol.
| Compound Name | (Z,2S)-2-ethylhex-4-en-1-ol |
|---|---|
| PubChem CID | 89381426 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.21 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | (Z,2S)-2-ethylhex-4-en-1-ol |
| SMILES | C/C=C\C[C@H](CC)CO |
| InChI | InChI=1S/C8H16O/c1-3-5-6-8(4-2)7-9/h3,5,8-9H,4,6-7H2,1-2H3/b5-3-/t8-/m0/s1 |
| InChIKey | UYBHMVMLMUZBSU-NHLYECAPSA-N |
| XLogP | 1.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.21 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|