C28H28Cl2N2O2 — CID 89382927
N-[3-[1-[[3-(3,5-dichlorophenoxy)phenyl]methyl]piperidin-4-yl]phenyl]-2-methylprop-2-enamide (PubChem CID 89382927) has the molecular formula C28H28Cl2N2O2 and a molecular weight of 495.45 g/mol. Its IUPAC name is N-[3-[1-[[3-(3,5-dichlorophenoxy)phenyl]methyl]piperidin-4-yl]phenyl]-2-methylprop-2-enamide.
| Compound Name | N-[3-[1-[[3-(3,5-dichlorophenoxy)phenyl]methyl]piperidin-4-yl]phenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 89382927 |
| Molecular Formula | C28H28Cl2N2O2 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | N-[3-[1-[[3-(3,5-dichlorophenoxy)phenyl]methyl]piperidin-4-yl]phenyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1cccc(C2CCN(Cc3cccc(Oc4cc(Cl)cc(Cl)c4)c3)CC2)c1 |
| InChI | InChI=1S/C28H28Cl2N2O2/c1-19(2)28(33)31-25-7-4-6-22(14-25)21-9-11-32(12-10-21)18-20-5-3-8-26(13-20)34-27-16-23(29)15-24(30)17-27/h3-8,13-17,21H,1,9-12,18H2,2H3,(H,31,33) |
| InChIKey | FQCPHCROHMHERI-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|