C8H10N2O4 — CID 89384903
1-ethyl-N,4-dihydroxy-2-oxopyridine-3-carboxamide (PubChem CID 89384903) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is 1-ethyl-N,4-dihydroxy-2-oxopyridine-3-carboxamide.
| Compound Name | 1-ethyl-N,4-dihydroxy-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 89384903 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 1-ethyl-N,4-dihydroxy-2-oxopyridine-3-carboxamide |
| SMILES | CCn1ccc(O)c(C(=O)NO)c1=O |
| InChI | InChI=1S/C8H10N2O4/c1-2-10-4-3-5(11)6(8(10)13)7(12)9-14/h3-4,11,14H,2H2,1H3,(H,9,12) |
| InChIKey | MLFPIAKIZYIQFE-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|