About 1-ethyl-N,4-dihydroxy-2-oxopyridine-3-carboxamide
1-ethyl-N,4-dihydroxy-2-oxopyridine-3-carboxamide (PubChem CID 89384903) has the molecular formula C8H10N2O4
and a molecular weight of 198.18 g/mol. Its IUPAC name is 1-ethyl-N,4-dihydroxy-2-oxopyridine-3-carboxamide.
Molecular Properties
| Compound Name | 1-ethyl-N,4-dihydroxy-2-oxopyridine-3-carboxamide |
| PubChem CID | 89384903 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 1-ethyl-N,4-dihydroxy-2-oxopyridine-3-carboxamide |
| SMILES | CCn1ccc(O)c(C(=O)NO)c1=O |
| InChI | InChI=1S/C8H10N2O4/c1-2-10-4-3-5(11)6(8(10)13)7(12)9-14/h3-4,11,14H,2H2,1H3,(H,9,12) |
| InChIKey | MLFPIAKIZYIQFE-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-N,4-dihydroxy-2-oxopyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-N,4-dihydroxy-2-oxopyridine-3-carboxamide?
The IUPAC name of 1-ethyl-N,4-dihydroxy-2-oxopyridine-3-carboxamide (CID 89384903) is 1-ethyl-N,4-dihydroxy-2-oxopyridine-3-carboxamide.
What is the SMILES notation for 1-ethyl-N,4-dihydroxy-2-oxopyridine-3-carboxamide?
The canonical SMILES for 1-ethyl-N,4-dihydroxy-2-oxopyridine-3-carboxamide is CCn1ccc(O)c(C(=O)NO)c1=O.
What is the InChIKey of 1-ethyl-N,4-dihydroxy-2-oxopyridine-3-carboxamide?
The InChIKey is MLFPIAKIZYIQFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O4/c1-2-10-4-3-5(11)6(8(10)13)7(12)9-14/h3-4,11,14H,2H2,1H3,(H,9,12).
What are the key properties of 1-ethyl-N,4-dihydroxy-2-oxopyridine-3-carboxamide?
1-ethyl-N,4-dihydroxy-2-oxopyridine-3-carboxamide has a molecular weight of 198.18 g/mol, XLogP of -0.31, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-N,4-dihydroxy-2-oxopyridine-3-carboxamide is sourced from PubChem (CID 89384903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).