C23H18ClIN2O3 — CID 89385329
2-[3-(2-chloro-5-cyanophenoxy)-4-methoxyphenyl]-N-[2-(iodomethyl)phenyl]acetamide (PubChem CID 89385329) has the molecular formula C23H18ClIN2O3 and a molecular weight of 532.77 g/mol. Its IUPAC name is 2-[3-(2-chloro-5-cyanophenoxy)-4-methoxyphenyl]-N-[2-(iodomethyl)phenyl]acetamide.
| Compound Name | 2-[3-(2-chloro-5-cyanophenoxy)-4-methoxyphenyl]-N-[2-(iodomethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 89385329 |
| Molecular Formula | C23H18ClIN2O3 |
| Molecular Weight | 532.77 g/mol |
| Exact Mass | 532.01 |
| IUPAC Name | 2-[3-(2-chloro-5-cyanophenoxy)-4-methoxyphenyl]-N-[2-(iodomethyl)phenyl]acetamide |
| SMILES | COc1ccc(CC(=O)Nc2ccccc2CI)cc1Oc1cc(C#N)ccc1Cl |
| InChI | InChI=1S/C23H18ClIN2O3/c1-29-20-9-7-15(12-23(28)27-19-5-3-2-4-17(19)13-25)10-22(20)30-21-11-16(14-26)6-8-18(21)24/h2-11H,12-13H2,1H3,(H,27,28) |
| InChIKey | TZMJDAMDLDDRIU-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.77 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|