C20H28ClN5O4 — CID 89389093
dibutyl 2-(8-chloroimidazo[1,5-a]pyrazin-3-yl)piperazine-1,4-dicarboxylate (PubChem CID 89389093) has the molecular formula C20H28ClN5O4 and a molecular weight of 437.93 g/mol. Its IUPAC name is dibutyl 2-(8-chloroimidazo[1,5-a]pyrazin-3-yl)piperazine-1,4-dicarboxylate.
| Compound Name | dibutyl 2-(8-chloroimidazo[1,5-a]pyrazin-3-yl)piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 89389093 |
| Molecular Formula | C20H28ClN5O4 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | dibutyl 2-(8-chloroimidazo[1,5-a]pyrazin-3-yl)piperazine-1,4-dicarboxylate |
| SMILES | CCCCOC(=O)N1CCN(C(=O)OCCCC)C(c2ncc3c(Cl)nccn23)C1 |
| InChI | InChI=1S/C20H28ClN5O4/c1-3-5-11-29-19(27)24-9-10-26(20(28)30-12-6-4-2)16(14-24)18-23-13-15-17(21)22-7-8-25(15)18/h7-8,13,16H,3-6,9-12,14H2,1-2H3 |
| InChIKey | PUBNIQANHUBCFU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 89.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|