C21H15FN2O5 — CID 8938911
[5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-(2,3-dioxoindol-1-yl)acetate (PubChem CID 8938911) has the molecular formula C21H15FN2O5 and a molecular weight of 394.36 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-(2,3-dioxoindol-1-yl)acetate.
| Compound Name | [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-(2,3-dioxoindol-1-yl)acetate |
|---|---|
| PubChem CID | 8938911 |
| Molecular Formula | C21H15FN2O5 |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-(2,3-dioxoindol-1-yl)acetate |
| SMILES | Cc1c(COC(=O)CN2C(=O)C(=O)c3ccccc32)noc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H15FN2O5/c1-12-16(23-29-20(12)13-6-8-14(22)9-7-13)11-28-18(25)10-24-17-5-3-2-4-15(17)19(26)21(24)27/h2-9H,10-11H2,1H3 |
| InChIKey | ACQFSWOUWKPUGN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|