About 4-(4-methylphenyl)-3,4-dihydropyridine
4-(4-methylphenyl)-3,4-dihydropyridine (PubChem CID 89391273) has the molecular formula C12H13N
and a molecular weight of 171.24 g/mol. Its IUPAC name is 4-(4-methylphenyl)-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 4-(4-methylphenyl)-3,4-dihydropyridine |
| PubChem CID | 89391273 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 4-(4-methylphenyl)-3,4-dihydropyridine |
| SMILES | Cc1ccc(C2C=CN=CC2)cc1 |
| InChI | InChI=1S/C12H13N/c1-10-2-4-11(5-3-10)12-6-8-13-9-7-12/h2-6,8-9,12H,7H2,1H3 |
| InChIKey | XZZSOOBPNDYLCQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(4-methylphenyl)-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylphenyl)-3,4-dihydropyridine?
The IUPAC name of 4-(4-methylphenyl)-3,4-dihydropyridine (CID 89391273) is 4-(4-methylphenyl)-3,4-dihydropyridine.
What is the SMILES notation for 4-(4-methylphenyl)-3,4-dihydropyridine?
The canonical SMILES for 4-(4-methylphenyl)-3,4-dihydropyridine is Cc1ccc(C2C=CN=CC2)cc1.
What is the InChIKey of 4-(4-methylphenyl)-3,4-dihydropyridine?
The InChIKey is XZZSOOBPNDYLCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N/c1-10-2-4-11(5-3-10)12-6-8-13-9-7-12/h2-6,8-9,12H,7H2,1H3.
What are the key properties of 4-(4-methylphenyl)-3,4-dihydropyridine?
4-(4-methylphenyl)-3,4-dihydropyridine has a molecular weight of 171.24 g/mol, XLogP of 3.07, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylphenyl)-3,4-dihydropyridine is sourced from PubChem (CID 89391273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).