C8H13NO2 — CID 89393525
2,3-dimethyl-N-(2-oxoethyl)but-2-enamide (PubChem CID 89393525) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 2,3-dimethyl-N-(2-oxoethyl)but-2-enamide.
| Compound Name | 2,3-dimethyl-N-(2-oxoethyl)but-2-enamide |
|---|---|
| PubChem CID | 89393525 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 2,3-dimethyl-N-(2-oxoethyl)but-2-enamide |
| SMILES | CC(C)=C(C)C(=O)NCC=O |
| InChI | InChI=1S/C8H13NO2/c1-6(2)7(3)8(11)9-4-5-10/h5H,4H2,1-3H3,(H,9,11) |
| InChIKey | NCSXEGWFFGBIAD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|