C22H34S — CID 89394764
2,5-dimethyl-2-[3-methyl-3-(4-methylcyclohex-2-en-1-yl)cyclohexen-1-yl]cyclohex-3-ene-1-thiol (PubChem CID 89394764) has the molecular formula C22H34S and a molecular weight of 330.58 g/mol. Its IUPAC name is 2,5-dimethyl-2-[3-methyl-3-(4-methylcyclohex-2-en-1-yl)cyclohexen-1-yl]cyclohex-3-ene-1-thiol.
| Compound Name | 2,5-dimethyl-2-[3-methyl-3-(4-methylcyclohex-2-en-1-yl)cyclohexen-1-yl]cyclohex-3-ene-1-thiol |
|---|---|
| PubChem CID | 89394764 |
| Molecular Formula | C22H34S |
| Molecular Weight | 330.58 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | 2,5-dimethyl-2-[3-methyl-3-(4-methylcyclohex-2-en-1-yl)cyclohexen-1-yl]cyclohex-3-ene-1-thiol |
| SMILES | CC1C=CC(C2(C)C=C(C3(C)C=CC(C)CC3S)CCC2)CC1 |
| InChI | InChI=1S/C22H34S/c1-16-7-9-18(10-8-16)21(3)12-5-6-19(15-21)22(4)13-11-17(2)14-20(22)23/h7,9,11,13,15-18,20,23H,5-6,8,10,12,14H2,1-4H3 |
| InChIKey | HMUDZGBEYWTGBJ-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.58 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|