C24H38O4 — CID 163128727
[(1R,3aR,4E,6R,10E,12S,12aS)-1-(2-acetyloxypropan-2-yl)-3a,6,10-trimethyl-2,3,6,7,8,9,12,12a-octahydro-1H-cyclopenta[11]annulen-12-yl] acetate (PubChem CID 163128727) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is [(1R,3aR,4E,6R,10E,12S,12aS)-1-(2-acetyloxypropan-2-yl)-3a,6,10-trimethyl-2,3,6,7,8,9,12,12a-octahydro-1H-cyclopenta[11]annulen-12-yl] acetate.
| Compound Name | [(1R,3aR,4E,6R,10E,12S,12aS)-1-(2-acetyloxypropan-2-yl)-3a,6,10-trimethyl-2,3,6,7,8,9,12,12a-octahydro-1H-cyclopenta[11]annulen-12-yl] acetate |
|---|---|
| PubChem CID | 163128727 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | [(1R,3aR,4E,6R,10E,12S,12aS)-1-(2-acetyloxypropan-2-yl)-3a,6,10-trimethyl-2,3,6,7,8,9,12,12a-octahydro-1H-cyclopenta[11]annulen-12-yl] acetate |
| SMILES | CC(=O)O[C@H]1/C=C(\C)CCC[C@@H](C)/C=C/[C@@]2(C)CC[C@@H](C(C)(C)OC(C)=O)[C@H]12 |
| InChI | InChI=1S/C24H38O4/c1-16-9-8-10-17(2)15-21(27-18(3)25)22-20(23(5,6)28-19(4)26)12-14-24(22,7)13-11-16/h11,13,15-16,20-22H,8-10,12,14H2,1-7H3/b13-11+,17-15+/t16-,20-,21+,22-,24+/m1/s1 |
| InChIKey | FHPMUALLITYSMM-IDLCWYIRSA-N |
| XLogP | 5.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|