C22H36O4 — CID 85198651
[4-hydroxy-3-(2-hydroxypropan-2-yl)-6,10,12a-trimethyl-2,3,3a,4,5,8,9,10-octahydro-1H-cyclopenta[11]annulen-9-yl] acetate (PubChem CID 85198651) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is [4-hydroxy-3-(2-hydroxypropan-2-yl)-6,10,12a-trimethyl-2,3,3a,4,5,8,9,10-octahydro-1H-cyclopenta[11]annulen-9-yl] acetate.
| Compound Name | [4-hydroxy-3-(2-hydroxypropan-2-yl)-6,10,12a-trimethyl-2,3,3a,4,5,8,9,10-octahydro-1H-cyclopenta[11]annulen-9-yl] acetate |
|---|---|
| PubChem CID | 85198651 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | [4-hydroxy-3-(2-hydroxypropan-2-yl)-6,10,12a-trimethyl-2,3,3a,4,5,8,9,10-octahydro-1H-cyclopenta[11]annulen-9-yl] acetate |
| SMILES | CC(=O)OC1CC=C(C)CC(O)C2C(C(C)(C)O)CCC2(C)C=CC1C |
| InChI | InChI=1S/C22H36O4/c1-14-7-8-19(26-16(3)23)15(2)9-11-22(6)12-10-17(21(4,5)25)20(22)18(24)13-14/h7,9,11,15,17-20,24-25H,8,10,12-13H2,1-6H3 |
| InChIKey | LDLGSJAYMQJUJA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|