C22H36O4 — CID 162938655
2-[(1R,3aR,4E,6R,9E,12S)-8,12-dihydroxy-3a,6,10-trimethyl-2,3,6,7,8,11,12,12a-octahydro-1H-cyclopenta[11]annulen-1-yl]propan-2-yl acetate (PubChem CID 162938655) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is 2-[(1R,3aR,4E,6R,9E,12S)-8,12-dihydroxy-3a,6,10-trimethyl-2,3,6,7,8,11,12,12a-octahydro-1H-cyclopenta[11]annulen-1-yl]propan-2-yl acetate.
| Compound Name | 2-[(1R,3aR,4E,6R,9E,12S)-8,12-dihydroxy-3a,6,10-trimethyl-2,3,6,7,8,11,12,12a-octahydro-1H-cyclopenta[11]annulen-1-yl]propan-2-yl acetate |
|---|---|
| PubChem CID | 162938655 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 2-[(1R,3aR,4E,6R,9E,12S)-8,12-dihydroxy-3a,6,10-trimethyl-2,3,6,7,8,11,12,12a-octahydro-1H-cyclopenta[11]annulen-1-yl]propan-2-yl acetate |
| SMILES | CC(=O)OC(C)(C)C1CC[C@]2(C)/C=C/[C@H](C)CC(O)/C=C(\C)C[C@H](O)C12 |
| InChI | InChI=1S/C22H36O4/c1-14-7-9-22(6)10-8-18(21(4,5)26-16(3)23)20(22)19(25)13-15(2)12-17(24)11-14/h7,9,12,14,17-20,24-25H,8,10-11,13H2,1-6H3/b9-7+,15-12+/t14-,17?,18?,19-,20?,22-/m0/s1 |
| InChIKey | YVXKBXZXMGSJNO-HVLRXHAQSA-N |
| XLogP | 4.01 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|