C17H32N2O3 — CID 89394882
3-[(3Z,5E)-3-amino-6-(dibutylamino)hexa-1,3,5-trien-2-yl]oxypropane-1,2-diol (PubChem CID 89394882) has the molecular formula C17H32N2O3 and a molecular weight of 312.45 g/mol. Its IUPAC name is 3-[(3Z,5E)-3-amino-6-(dibutylamino)hexa-1,3,5-trien-2-yl]oxypropane-1,2-diol.
| Compound Name | 3-[(3Z,5E)-3-amino-6-(dibutylamino)hexa-1,3,5-trien-2-yl]oxypropane-1,2-diol |
|---|---|
| PubChem CID | 89394882 |
| Molecular Formula | C17H32N2O3 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.24 |
| IUPAC Name | 3-[(3Z,5E)-3-amino-6-(dibutylamino)hexa-1,3,5-trien-2-yl]oxypropane-1,2-diol |
| SMILES | C=C(OCC(O)CO)/C(N)=C/C=C/N(CCCC)CCCC |
| InChI | InChI=1S/C17H32N2O3/c1-4-6-10-19(11-7-5-2)12-8-9-17(18)15(3)22-14-16(21)13-20/h8-9,12,16,20-21H,3-7,10-11,13-14,18H2,1-2H3/b12-8+,17-9- |
| InChIKey | PDCLZPHEYQQKCR-PFYYBVRVSA-N |
| XLogP | 2.13 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|