C20H18N2O2S — CID 89395166
(Z)-3-imino-1-[4-[4-(thiophen-3-ylmethoxy)phenoxy]phenyl]prop-1-en-1-amine (PubChem CID 89395166) has the molecular formula C20H18N2O2S and a molecular weight of 350.44 g/mol. Its IUPAC name is (Z)-3-imino-1-[4-[4-(thiophen-3-ylmethoxy)phenoxy]phenyl]prop-1-en-1-amine.
| Compound Name | (Z)-3-imino-1-[4-[4-(thiophen-3-ylmethoxy)phenoxy]phenyl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 89395166 |
| Molecular Formula | C20H18N2O2S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | (Z)-3-imino-1-[4-[4-(thiophen-3-ylmethoxy)phenoxy]phenyl]prop-1-en-1-amine |
| SMILES | [H]/N=C/C=C(\N)c1ccc(Oc2ccc(OCc3ccsc3)cc2)cc1 |
| InChI | InChI=1S/C20H18N2O2S/c21-11-9-20(22)16-1-3-18(4-2-16)24-19-7-5-17(6-8-19)23-13-15-10-12-25-14-15/h1-12,14,21H,13,22H2/b20-9-,21-11+ |
| InChIKey | FNCYRZSYDHRMNL-VIVBUISQSA-N |
| XLogP | 5.07 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|