C17H18N2O3 — CID 89397607
prop-1-en-2-yl (2S)-2-(3-amino-2-oxo-1-pyridinyl)-3-phenylpropanoate (PubChem CID 89397607) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is prop-1-en-2-yl (2S)-2-(3-amino-2-oxo-1-pyridinyl)-3-phenylpropanoate.
| Compound Name | prop-1-en-2-yl (2S)-2-(3-amino-2-oxo-1-pyridinyl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 89397607 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | prop-1-en-2-yl (2S)-2-(3-amino-2-oxo-1-pyridinyl)-3-phenylpropanoate |
| SMILES | C=C(C)OC(=O)[C@H](Cc1ccccc1)n1cccc(N)c1=O |
| InChI | InChI=1S/C17H18N2O3/c1-12(2)22-17(21)15(11-13-7-4-3-5-8-13)19-10-6-9-14(18)16(19)20/h3-10,15H,1,11,18H2,2H3/t15-/m0/s1 |
| InChIKey | NLYCJJZCBMPTSZ-HNNXBMFYSA-N |
| XLogP | 2.29 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|