C21H20N2O4 — CID 10316701
methyl 2-(3-benzyl-2,4-dioxopyrimidin-1-yl)-3-phenylpropanoate (PubChem CID 10316701) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is methyl 2-(3-benzyl-2,4-dioxopyrimidin-1-yl)-3-phenylpropanoate.
| Compound Name | methyl 2-(3-benzyl-2,4-dioxopyrimidin-1-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 10316701 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | methyl 2-(3-benzyl-2,4-dioxopyrimidin-1-yl)-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)n1ccc(=O)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C21H20N2O4/c1-27-20(25)18(14-16-8-4-2-5-9-16)22-13-12-19(24)23(21(22)26)15-17-10-6-3-7-11-17/h2-13,18H,14-15H2,1H3 |
| InChIKey | TZMSKMGCHCVEFU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |