C34H41NO3 — CID 89398611
2-[[1-(4-butan-2-ylphenoxy)-2-cyclohexyl-2-(1H-indol-3-yl)propoxy]methyl]phenol (PubChem CID 89398611) has the molecular formula C34H41NO3 and a molecular weight of 511.71 g/mol. Its IUPAC name is 2-[[1-(4-butan-2-ylphenoxy)-2-cyclohexyl-2-(1H-indol-3-yl)propoxy]methyl]phenol.
| Compound Name | 2-[[1-(4-butan-2-ylphenoxy)-2-cyclohexyl-2-(1H-indol-3-yl)propoxy]methyl]phenol |
|---|---|
| PubChem CID | 89398611 |
| Molecular Formula | C34H41NO3 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | 2-[[1-(4-butan-2-ylphenoxy)-2-cyclohexyl-2-(1H-indol-3-yl)propoxy]methyl]phenol |
| SMILES | CCC(C)c1ccc(OC(OCc2ccccc2O)C(C)(c2c[nH]c3ccccc23)C2CCCCC2)cc1 |
| InChI | InChI=1S/C34H41NO3/c1-4-24(2)25-18-20-28(21-19-25)38-33(37-23-26-12-8-11-17-32(26)36)34(3,27-13-6-5-7-14-27)30-22-35-31-16-10-9-15-29(30)31/h8-12,15-22,24,27,33,35-36H,4-7,13-14,23H2,1-3H3 |
| InChIKey | BSARACKPOYGVJA-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 54.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|