C27H31N3O3 — CID 43811744
N-cyclohexyl-2-[cyclopropyl-[2-(1H-indol-3-yl)acetyl]amino]-2-(4-hydroxyphenyl)acetamide (PubChem CID 43811744) has the molecular formula C27H31N3O3 and a molecular weight of 445.56 g/mol. Its IUPAC name is N-cyclohexyl-2-[cyclopropyl-[2-(1H-indol-3-yl)acetyl]amino]-2-(4-hydroxyphenyl)acetamide.
| Compound Name | N-cyclohexyl-2-[cyclopropyl-[2-(1H-indol-3-yl)acetyl]amino]-2-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 43811744 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | N-cyclohexyl-2-[cyclopropyl-[2-(1H-indol-3-yl)acetyl]amino]-2-(4-hydroxyphenyl)acetamide |
| SMILES | O=C(NC1CCCCC1)C(c1ccc(O)cc1)N(C(=O)Cc1c[nH]c2ccccc12)C1CC1 |
| InChI | InChI=1S/C27H31N3O3/c31-22-14-10-18(11-15-22)26(27(33)29-20-6-2-1-3-7-20)30(21-12-13-21)25(32)16-19-17-28-24-9-5-4-8-23(19)24/h4-5,8-11,14-15,17,20-21,26,28,31H,1-3,6-7,12-13,16H2,(H,29,33) |
| InChIKey | SQUQMPLYEUSCGU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |