C29H31N3O3 — CID 25309476
(2S)-2-[benzyl-[2-(1H-indol-3-yl)acetyl]amino]-N-cyclohexyl-2-(furan-2-yl)acetamide (PubChem CID 25309476) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is (2S)-2-[benzyl-[2-(1H-indol-3-yl)acetyl]amino]-N-cyclohexyl-2-(furan-2-yl)acetamide.
| Compound Name | (2S)-2-[benzyl-[2-(1H-indol-3-yl)acetyl]amino]-N-cyclohexyl-2-(furan-2-yl)acetamide |
|---|---|
| PubChem CID | 25309476 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | (2S)-2-[benzyl-[2-(1H-indol-3-yl)acetyl]amino]-N-cyclohexyl-2-(furan-2-yl)acetamide |
| SMILES | O=C(NC1CCCCC1)[C@H](c1ccco1)N(Cc1ccccc1)C(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C29H31N3O3/c33-27(18-22-19-30-25-15-8-7-14-24(22)25)32(20-21-10-3-1-4-11-21)28(26-16-9-17-35-26)29(34)31-23-12-5-2-6-13-23/h1,3-4,7-11,14-17,19,23,28,30H,2,5-6,12-13,18,20H2,(H,31,34)/t28-/m0/s1 |
| InChIKey | MNCWJDLWTUJJIO-NDEPHWFRSA-N |
| XLogP | 5.52 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |