C26H20Cl6O8 — CID 89398716
1-O-[3,4,6-trichloro-2-[(2-methylcyclopropyl)methoxycarbonyl]phenyl] 2-O-[3,4,6-trichloro-2-[[(2S)-2-methylcyclopropyl]methoxycarbonyl]phenyl] oxalate (PubChem CID 89398716) has the molecular formula C26H20Cl6O8 and a molecular weight of 673.16 g/mol. Its IUPAC name is 1-O-[3,4,6-trichloro-2-[(2-methylcyclopropyl)methoxycarbonyl]phenyl] 2-O-[3,4,6-trichloro-2-[[(2S)-2-methylcyclopropyl]methoxycarbonyl]phenyl] oxalate.
| Compound Name | 1-O-[3,4,6-trichloro-2-[(2-methylcyclopropyl)methoxycarbonyl]phenyl] 2-O-[3,4,6-trichloro-2-[[(2S)-2-methylcyclopropyl]methoxycarbonyl]phenyl] oxalate |
|---|---|
| PubChem CID | 89398716 |
| Molecular Formula | C26H20Cl6O8 |
| Molecular Weight | 673.16 g/mol |
| Exact Mass | 669.93 |
| IUPAC Name | 1-O-[3,4,6-trichloro-2-[(2-methylcyclopropyl)methoxycarbonyl]phenyl] 2-O-[3,4,6-trichloro-2-[[(2S)-2-methylcyclopropyl]methoxycarbonyl]phenyl] oxalate |
| SMILES | CC1CC1COC(=O)c1c(Cl)c(Cl)cc(Cl)c1OC(=O)C(=O)Oc1c(Cl)cc(Cl)c(Cl)c1C(=O)OCC1C[C@@H]1C |
| InChI | InChI=1S/C26H20Cl6O8/c1-9-3-11(9)7-37-23(33)17-19(31)13(27)5-15(29)21(17)39-25(35)26(36)40-22-16(30)6-14(28)20(32)18(22)24(34)38-8-12-4-10(12)2/h5-6,9-12H,3-4,7-8H2,1-2H3/t9-,10?,11?,12?/m0/s1 |
| InChIKey | LEDITJSGENYGIF-ZLMIFYAYSA-N |
| XLogP | 7.74 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.16 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|