C17H15Cl3O6 — CID 154000520
2-[2-(2-bicyclo[2.2.1]heptanylmethoxycarbonyl)-3,4,6-trichlorophenoxy]-2-oxoacetic acid (PubChem CID 154000520) has the molecular formula C17H15Cl3O6 and a molecular weight of 421.66 g/mol. Its IUPAC name is 2-[2-(2-bicyclo[2.2.1]heptanylmethoxycarbonyl)-3,4,6-trichlorophenoxy]-2-oxoacetic acid.
| Compound Name | 2-[2-(2-bicyclo[2.2.1]heptanylmethoxycarbonyl)-3,4,6-trichlorophenoxy]-2-oxoacetic acid |
|---|---|
| PubChem CID | 154000520 |
| Molecular Formula | C17H15Cl3O6 |
| Molecular Weight | 421.66 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | 2-[2-(2-bicyclo[2.2.1]heptanylmethoxycarbonyl)-3,4,6-trichlorophenoxy]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)Oc1c(Cl)cc(Cl)c(Cl)c1C(=O)OCC1CC2CCC1C2 |
| InChI | InChI=1S/C17H15Cl3O6/c18-10-5-11(19)14(26-17(24)15(21)22)12(13(10)20)16(23)25-6-9-4-7-1-2-8(9)3-7/h5,7-9H,1-4,6H2,(H,21,22) |
| InChIKey | QDUSBEFXGXDXNX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.66 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|