C16H17Cl3O6 — CID 150112016
2-oxo-2-[3,4,6-trichloro-2-(2,2-dimethylpentoxycarbonyl)phenoxy]acetic acid (PubChem CID 150112016) has the molecular formula C16H17Cl3O6 and a molecular weight of 411.67 g/mol. Its IUPAC name is 2-oxo-2-[3,4,6-trichloro-2-(2,2-dimethylpentoxycarbonyl)phenoxy]acetic acid.
| Compound Name | 2-oxo-2-[3,4,6-trichloro-2-(2,2-dimethylpentoxycarbonyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 150112016 |
| Molecular Formula | C16H17Cl3O6 |
| Molecular Weight | 411.67 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | 2-oxo-2-[3,4,6-trichloro-2-(2,2-dimethylpentoxycarbonyl)phenoxy]acetic acid |
| SMILES | CCCC(C)(C)COC(=O)c1c(Cl)c(Cl)cc(Cl)c1OC(=O)C(=O)O |
| InChI | InChI=1S/C16H17Cl3O6/c1-4-5-16(2,3)7-24-14(22)10-11(19)8(17)6-9(18)12(10)25-15(23)13(20)21/h6H,4-5,7H2,1-3H3,(H,20,21) |
| InChIKey | DXLOHVXIXHFYLE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.67 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|