C26H37ClO6 — CID 89399390
[8-[2-(4-carbonochloridoyloxy-6-oxooxan-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 89399390) has the molecular formula C26H37ClO6 and a molecular weight of 481.03 g/mol. Its IUPAC name is [8-[2-(4-carbonochloridoyloxy-6-oxooxan-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [8-[2-(4-carbonochloridoyloxy-6-oxooxan-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 89399390 |
| Molecular Formula | C26H37ClO6 |
| Molecular Weight | 481.03 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | [8-[2-(4-carbonochloridoyloxy-6-oxooxan-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CC(C)C=C2C=CC(C)C(CCC3CC(OC(=O)Cl)CC(=O)O3)C21 |
| InChI | InChI=1S/C26H37ClO6/c1-6-26(4,5)24(29)33-21-12-15(2)11-17-8-7-16(3)20(23(17)21)10-9-18-13-19(32-25(27)30)14-22(28)31-18/h7-8,11,15-16,18-21,23H,6,9-10,12-14H2,1-5H3 |
| InChIKey | LMDYECKKKUJPHL-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.03 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|