C28H44O5 — CID 58846986
[3,7-dimethyl-8-[2-(6-oxo-4-propan-2-yloxyoxan-2-yl)ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 58846986) has the molecular formula C28H44O5 and a molecular weight of 460.66 g/mol. Its IUPAC name is [3,7-dimethyl-8-[2-(6-oxo-4-propan-2-yloxyoxan-2-yl)ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [3,7-dimethyl-8-[2-(6-oxo-4-propan-2-yloxyoxan-2-yl)ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58846986 |
| Molecular Formula | C28H44O5 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | [3,7-dimethyl-8-[2-(6-oxo-4-propan-2-yloxyoxan-2-yl)ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CC(C)C=C2C=CC(C)C(CCC3CC(OC(C)C)CC(=O)O3)C21 |
| InChI | InChI=1S/C28H44O5/c1-8-28(6,7)27(30)33-24-14-18(4)13-20-10-9-19(5)23(26(20)24)12-11-21-15-22(31-17(2)3)16-25(29)32-21/h9-10,13,17-19,21-24,26H,8,11-12,14-16H2,1-7H3 |
| InChIKey | JCIRSHMEPOPINX-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |