C24H25N7O — CID 89400152
2-[4-[(2,4-dimethyl-7-oxo-5,6-dihydropyrido[2,3-d]pyrimidin-8-yl)methyl]phenyl]-N'-hydrazinyl-N-methylidenebenzenecarboximidamide (PubChem CID 89400152) has the molecular formula C24H25N7O and a molecular weight of 427.51 g/mol. Its IUPAC name is 2-[4-[(2,4-dimethyl-7-oxo-5,6-dihydropyrido[2,3-d]pyrimidin-8-yl)methyl]phenyl]-N'-hydrazinyl-N-methylidenebenzenecarboximidamide.
| Compound Name | 2-[4-[(2,4-dimethyl-7-oxo-5,6-dihydropyrido[2,3-d]pyrimidin-8-yl)methyl]phenyl]-N'-hydrazinyl-N-methylidenebenzenecarboximidamide |
|---|---|
| PubChem CID | 89400152 |
| Molecular Formula | C24H25N7O |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 2-[4-[(2,4-dimethyl-7-oxo-5,6-dihydropyrido[2,3-d]pyrimidin-8-yl)methyl]phenyl]-N'-hydrazinyl-N-methylidenebenzenecarboximidamide |
| SMILES | C=N/C(=N\NN)c1ccccc1-c1ccc(CN2C(=O)CCc3c(C)nc(C)nc32)cc1 |
| InChI | InChI=1S/C24H25N7O/c1-15-19-12-13-22(32)31(24(19)28-16(2)27-15)14-17-8-10-18(11-9-17)20-6-4-5-7-21(20)23(26-3)29-30-25/h4-11,30H,3,12-14,25H2,1-2H3/b29-23- |
| InChIKey | GZKDMQVSVIJUEK-FAJYDZGRSA-N |
| XLogP | 3.07 |
| TPSA | 108.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|