C33H30N8O7 — CID 143266255
1-[5-[2-[4-[(2,4-dimethyl-7-oxo-5,6-dihydropyrido[2,3-d]pyrimidin-8-yl)methyl]phenyl]phenyl]tetrazol-2-yl]ethyl [2-(nitrooxymethyl)phenyl] carbonate (PubChem CID 143266255) has the molecular formula C33H30N8O7 and a molecular weight of 650.65 g/mol. Its IUPAC name is 1-[5-[2-[4-[(2,4-dimethyl-7-oxo-5,6-dihydropyrido[2,3-d]pyrimidin-8-yl)methyl]phenyl]phenyl]tetrazol-2-yl]ethyl [2-(nitrooxymethyl)phenyl] carbonate.
| Compound Name | 1-[5-[2-[4-[(2,4-dimethyl-7-oxo-5,6-dihydropyrido[2,3-d]pyrimidin-8-yl)methyl]phenyl]phenyl]tetrazol-2-yl]ethyl [2-(nitrooxymethyl)phenyl] carbonate |
|---|---|
| PubChem CID | 143266255 |
| Molecular Formula | C33H30N8O7 |
| Molecular Weight | 650.65 g/mol |
| Exact Mass | 650.22 |
| IUPAC Name | 1-[5-[2-[4-[(2,4-dimethyl-7-oxo-5,6-dihydropyrido[2,3-d]pyrimidin-8-yl)methyl]phenyl]phenyl]tetrazol-2-yl]ethyl [2-(nitrooxymethyl)phenyl] carbonate |
| SMILES | Cc1nc(C)c2c(n1)N(Cc1ccc(-c3ccccc3-c3nnn(C(C)OC(=O)Oc4ccccc4CO[N+](=O)[O-])n3)cc1)C(=O)CC2 |
| InChI | InChI=1S/C33H30N8O7/c1-20-26-16-17-30(42)39(32(26)35-21(2)34-20)18-23-12-14-24(15-13-23)27-9-5-6-10-28(27)31-36-38-40(37-31)22(3)47-33(43)48-29-11-7-4-8-25(29)19-46-41(44)45/h4-15,22H,16-19H2,1-3H3 |
| InChIKey | SNAODWKVQBRULH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 177.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.65 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|