C20H29N5O10 — CID 89400995
2-[4,10-bis(carboxymethyl)-7-[2-(2,5-dioxopyrrol-1-yl)oxy-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 89400995) has the molecular formula C20H29N5O10 and a molecular weight of 499.48 g/mol. Its IUPAC name is 2-[4,10-bis(carboxymethyl)-7-[2-(2,5-dioxopyrrol-1-yl)oxy-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,10-bis(carboxymethyl)-7-[2-(2,5-dioxopyrrol-1-yl)oxy-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 89400995 |
| Molecular Formula | C20H29N5O10 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 2-[4,10-bis(carboxymethyl)-7-[2-(2,5-dioxopyrrol-1-yl)oxy-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)ON2C(=O)C=CC2=O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C20H29N5O10/c26-15-1-2-16(27)25(15)35-20(34)14-24-9-7-22(12-18(30)31)5-3-21(11-17(28)29)4-6-23(8-10-24)13-19(32)33/h1-2H,3-14H2,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | HDTPONPWSVZVGA-UHFFFAOYSA-N |
| XLogP | -3.15 |
| TPSA | 188.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|