C8H12N2 — CID 89404660
5-ethyl-1,2,3,6-tetrahydropyridine-2-carbonitrile (PubChem CID 89404660) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 5-ethyl-1,2,3,6-tetrahydropyridine-2-carbonitrile.
| Compound Name | 5-ethyl-1,2,3,6-tetrahydropyridine-2-carbonitrile |
|---|---|
| PubChem CID | 89404660 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 5-ethyl-1,2,3,6-tetrahydropyridine-2-carbonitrile |
| SMILES | CCC1=CCC(C#N)NC1 |
| InChI | InChI=1S/C8H12N2/c1-2-7-3-4-8(5-9)10-6-7/h3,8,10H,2,4,6H2,1H3 |
| InChIKey | MTGXUHNBCWHAIJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|