C23H19F3O5 — CID 89408480
2-methylprop-2-enoyloxymethyl 10-(1,1,1-trifluoro-2-hydroxypropan-2-yl)anthracene-9-carboxylate (PubChem CID 89408480) has the molecular formula C23H19F3O5 and a molecular weight of 432.39 g/mol. Its IUPAC name is 2-methylprop-2-enoyloxymethyl 10-(1,1,1-trifluoro-2-hydroxypropan-2-yl)anthracene-9-carboxylate.
| Compound Name | 2-methylprop-2-enoyloxymethyl 10-(1,1,1-trifluoro-2-hydroxypropan-2-yl)anthracene-9-carboxylate |
|---|---|
| PubChem CID | 89408480 |
| Molecular Formula | C23H19F3O5 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 2-methylprop-2-enoyloxymethyl 10-(1,1,1-trifluoro-2-hydroxypropan-2-yl)anthracene-9-carboxylate |
| SMILES | C=C(C)C(=O)OCOC(=O)c1c2ccccc2c(C(C)(O)C(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C23H19F3O5/c1-13(2)20(27)30-12-31-21(28)18-14-8-4-6-10-16(14)19(22(3,29)23(24,25)26)17-11-7-5-9-15(17)18/h4-11,29H,1,12H2,2-3H3 |
| InChIKey | VXJQICRJFPQGQW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|