C21H17F3O3 — CID 89408495
[10-(1,1,1-trifluoro-2-hydroxypropan-2-yl)anthracen-9-yl]methyl prop-2-enoate (PubChem CID 89408495) has the molecular formula C21H17F3O3 and a molecular weight of 374.36 g/mol. Its IUPAC name is [10-(1,1,1-trifluoro-2-hydroxypropan-2-yl)anthracen-9-yl]methyl prop-2-enoate.
| Compound Name | [10-(1,1,1-trifluoro-2-hydroxypropan-2-yl)anthracen-9-yl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 89408495 |
| Molecular Formula | C21H17F3O3 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | [10-(1,1,1-trifluoro-2-hydroxypropan-2-yl)anthracen-9-yl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1c2ccccc2c(C(C)(O)C(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C21H17F3O3/c1-3-18(25)27-12-17-13-8-4-6-10-15(13)19(20(2,26)21(22,23)24)16-11-7-5-9-14(16)17/h3-11,26H,1,12H2,2H3 |
| InChIKey | KYMLIUUUXLYECK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|