C17H14Cl2N4O2S — CID 8941248
(2S)-2-[[1-(2-chlorophenyl)-5-oxo-4H-imidazol-2-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)propanamide (PubChem CID 8941248) has the molecular formula C17H14Cl2N4O2S and a molecular weight of 409.30 g/mol. Its IUPAC name is (2S)-2-[[1-(2-chlorophenyl)-5-oxo-4H-imidazol-2-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)propanamide.
| Compound Name | (2S)-2-[[1-(2-chlorophenyl)-5-oxo-4H-imidazol-2-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)propanamide |
|---|---|
| PubChem CID | 8941248 |
| Molecular Formula | C17H14Cl2N4O2S |
| Molecular Weight | 409.30 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | (2S)-2-[[1-(2-chlorophenyl)-5-oxo-4H-imidazol-2-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)propanamide |
| SMILES | C[C@H](SC1=NCC(=O)N1c1ccccc1Cl)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C17H14Cl2N4O2S/c1-10(16(25)22-12-6-4-8-20-15(12)19)26-17-21-9-14(24)23(17)13-7-3-2-5-11(13)18/h2-8,10H,9H2,1H3,(H,22,25)/t10-/m0/s1 |
| InChIKey | LFNQPDMGWIHPAS-JTQLQIEISA-N |
| XLogP | 3.85 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|