C22H31N5O4 — CID 89412892
1-aminopentan-3-yl N-[(1S)-1-[3-[(4-amino-3-methoxyphenyl)carbamoylamino]phenyl]ethyl]carbamate (PubChem CID 89412892) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is 1-aminopentan-3-yl N-[(1S)-1-[3-[(4-amino-3-methoxyphenyl)carbamoylamino]phenyl]ethyl]carbamate.
| Compound Name | 1-aminopentan-3-yl N-[(1S)-1-[3-[(4-amino-3-methoxyphenyl)carbamoylamino]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 89412892 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 1-aminopentan-3-yl N-[(1S)-1-[3-[(4-amino-3-methoxyphenyl)carbamoylamino]phenyl]ethyl]carbamate |
| SMILES | CCC(CCN)OC(=O)N[C@@H](C)c1cccc(NC(=O)Nc2ccc(N)c(OC)c2)c1 |
| InChI | InChI=1S/C22H31N5O4/c1-4-18(10-11-23)31-22(29)25-14(2)15-6-5-7-16(12-15)26-21(28)27-17-8-9-19(24)20(13-17)30-3/h5-9,12-14,18H,4,10-11,23-24H2,1-3H3,(H,25,29)(H2,26,27,28)/t14-,18?/m0/s1 |
| InChIKey | NGGJTZXIAUNXPS-PIVQAISJSA-N |
| XLogP | 3.84 |
| TPSA | 140.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|