C21H23N3O4 — CID 89413599
2-[cyclobutyl-(4-phenylbenzoyl)amino]-N-hydroxy-N'-methylpropanediamide (PubChem CID 89413599) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 2-[cyclobutyl-(4-phenylbenzoyl)amino]-N-hydroxy-N'-methylpropanediamide.
| Compound Name | 2-[cyclobutyl-(4-phenylbenzoyl)amino]-N-hydroxy-N'-methylpropanediamide |
|---|---|
| PubChem CID | 89413599 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 2-[cyclobutyl-(4-phenylbenzoyl)amino]-N-hydroxy-N'-methylpropanediamide |
| SMILES | CNC(=O)C(C(=O)NO)N(C(=O)c1ccc(-c2ccccc2)cc1)C1CCC1 |
| InChI | InChI=1S/C21H23N3O4/c1-22-19(25)18(20(26)23-28)24(17-8-5-9-17)21(27)16-12-10-15(11-13-16)14-6-3-2-4-7-14/h2-4,6-7,10-13,17-18,28H,5,8-9H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | GXEADVGIUASCEX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|