About dipropyl phosphate;1-ethyl-3-heptylimidazol-3-ium
dipropyl phosphate;1-ethyl-3-heptylimidazol-3-ium (PubChem CID 89414298) has the molecular formula C18H37N2O4P
and a molecular weight of 376.48 g/mol. Its IUPAC name is dipropyl phosphate;1-ethyl-3-heptylimidazol-3-ium.
Molecular Properties
| Compound Name | dipropyl phosphate;1-ethyl-3-heptylimidazol-3-ium |
| PubChem CID | 89414298 |
| Molecular Formula | C18H37N2O4P |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | dipropyl phosphate;1-ethyl-3-heptylimidazol-3-ium |
| SMILES | CCCCCCC[n+]1ccn(CC)c1.CCCOP(=O)([O-])OCCC |
| InChI | InChI=1S/C12H23N2.C6H15O4P/c1-3-5-6-7-8-9-14-11-10-13(4-2)12-14;1-3-5-9-11(7,8)10-6-4-2/h10-12H,3-9H2,1-2H3;3-6H2,1-2H3,(H,7,8)/q+1;/p-1 |
| InChIKey | BPZDFNQEZHKDSS-UHFFFAOYSA-M |
| XLogP | 4.07 |
| TPSA | 67.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze dipropyl phosphate;1-ethyl-3-heptylimidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropyl phosphate;1-ethyl-3-heptylimidazol-3-ium?
The IUPAC name of dipropyl phosphate;1-ethyl-3-heptylimidazol-3-ium (CID 89414298) is dipropyl phosphate;1-ethyl-3-heptylimidazol-3-ium.
What is the SMILES notation for dipropyl phosphate;1-ethyl-3-heptylimidazol-3-ium?
The canonical SMILES for dipropyl phosphate;1-ethyl-3-heptylimidazol-3-ium is CCCCCCC[n+]1ccn(CC)c1.CCCOP(=O)([O-])OCCC.
What is the InChIKey of dipropyl phosphate;1-ethyl-3-heptylimidazol-3-ium?
The InChIKey is BPZDFNQEZHKDSS-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H23N2.C6H15O4P/c1-3-5-6-7-8-9-14-11-10-13(4-2)12-14;1-3-5-9-11(7,8)10-6-4-2/h10-12H,3-9H2,1-2H3;3-6H2,1-2H3,(H,7,8)/q+1;/p-1.
What are the key properties of dipropyl phosphate;1-ethyl-3-heptylimidazol-3-ium?
dipropyl phosphate;1-ethyl-3-heptylimidazol-3-ium has a molecular weight of 376.48 g/mol, XLogP of 4.07, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dipropyl phosphate;1-ethyl-3-heptylimidazol-3-ium is sourced from PubChem (CID 89414298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).