About dibutyl phosphate;1-ethyl-3-octylimidazol-3-ium
dibutyl phosphate;1-ethyl-3-octylimidazol-3-ium (PubChem CID 89414254) has the molecular formula C21H43N2O4P
and a molecular weight of 418.56 g/mol. Its IUPAC name is dibutyl phosphate;1-ethyl-3-octylimidazol-3-ium.
Molecular Properties
| Compound Name | dibutyl phosphate;1-ethyl-3-octylimidazol-3-ium |
| PubChem CID | 89414254 |
| Molecular Formula | C21H43N2O4P |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.30 |
| IUPAC Name | dibutyl phosphate;1-ethyl-3-octylimidazol-3-ium |
| SMILES | CCCCCCCC[n+]1ccn(CC)c1.CCCCOP(=O)([O-])OCCCC |
| InChI | InChI=1S/C13H25N2.C8H19O4P/c1-3-5-6-7-8-9-10-15-12-11-14(4-2)13-15;1-3-5-7-11-13(9,10)12-8-6-4-2/h11-13H,3-10H2,1-2H3;3-8H2,1-2H3,(H,9,10)/q+1;/p-1 |
| InChIKey | WKJRYRXXBDLYJO-UHFFFAOYSA-M |
| XLogP | 5.24 |
| TPSA | 67.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze dibutyl phosphate;1-ethyl-3-octylimidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl phosphate;1-ethyl-3-octylimidazol-3-ium?
The IUPAC name of dibutyl phosphate;1-ethyl-3-octylimidazol-3-ium (CID 89414254) is dibutyl phosphate;1-ethyl-3-octylimidazol-3-ium.
What is the SMILES notation for dibutyl phosphate;1-ethyl-3-octylimidazol-3-ium?
The canonical SMILES for dibutyl phosphate;1-ethyl-3-octylimidazol-3-ium is CCCCCCCC[n+]1ccn(CC)c1.CCCCOP(=O)([O-])OCCCC.
What is the InChIKey of dibutyl phosphate;1-ethyl-3-octylimidazol-3-ium?
The InChIKey is WKJRYRXXBDLYJO-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H25N2.C8H19O4P/c1-3-5-6-7-8-9-10-15-12-11-14(4-2)13-15;1-3-5-7-11-13(9,10)12-8-6-4-2/h11-13H,3-10H2,1-2H3;3-8H2,1-2H3,(H,9,10)/q+1;/p-1.
What are the key properties of dibutyl phosphate;1-ethyl-3-octylimidazol-3-ium?
dibutyl phosphate;1-ethyl-3-octylimidazol-3-ium has a molecular weight of 418.56 g/mol, XLogP of 5.24, 16 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl phosphate;1-ethyl-3-octylimidazol-3-ium is sourced from PubChem (CID 89414254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).