C8H11FO — CID 89416434
(2E,4E)-5-fluoro-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-ol (PubChem CID 89416434) has the molecular formula C8H11FO and a molecular weight of 142.17 g/mol. Its IUPAC name is (2E,4E)-5-fluoro-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-ol.
| Compound Name | (2E,4E)-5-fluoro-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 89416434 |
| Molecular Formula | C8H11FO |
| Molecular Weight | 142.17 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | (2E,4E)-5-fluoro-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-ol |
| SMILES | C/C=C\C(=C/C=C/F)CO |
| InChI | InChI=1S/C8H11FO/c1-2-4-8(7-10)5-3-6-9/h2-6,10H,7H2,1H3/b4-2-,6-3+,8-5+ |
| InChIKey | BZTDDVLQTVZUGS-VVLKWLIRSA-N |
| XLogP | 1.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.17 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|