C9H12FN3O4S — CID 89421474
1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-yl]-4-(fluoroamino)pyrimidin-2-one (PubChem CID 89421474) has the molecular formula C9H12FN3O4S and a molecular weight of 277.28 g/mol. Its IUPAC name is 1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-yl]-4-(fluoroamino)pyrimidin-2-one.
| Compound Name | 1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-yl]-4-(fluoroamino)pyrimidin-2-one |
|---|---|
| PubChem CID | 89421474 |
| Molecular Formula | C9H12FN3O4S |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-yl]-4-(fluoroamino)pyrimidin-2-one |
| SMILES | O=c1nc(NF)ccn1[C@@H]1S[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H12FN3O4S/c10-12-5-1-2-13(9(17)11-5)8-7(16)6(15)4(3-14)18-8/h1-2,4,6-8,14-16H,3H2,(H,11,12,17)/t4-,6-,7+,8-/m1/s1 |
| InChIKey | RHMVEWRPKBGABB-CCXZUQQUSA-N |
| XLogP | -1.13 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|