C10H15N3O5S — CID 171762984
1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-4-methylthiolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one (PubChem CID 171762984) has the molecular formula C10H15N3O5S and a molecular weight of 289.31 g/mol. Its IUPAC name is 1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-4-methylthiolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one.
| Compound Name | 1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-4-methylthiolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one |
|---|---|
| PubChem CID | 171762984 |
| Molecular Formula | C10H15N3O5S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-4-methylthiolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one |
| SMILES | CC1(O)[C@H](O)[C@H](n2ccc(NO)nc2=O)S[C@@H]1CO |
| InChI | InChI=1S/C10H15N3O5S/c1-10(17)5(4-14)19-8(7(10)15)13-3-2-6(12-18)11-9(13)16/h2-3,5,7-8,14-15,17-18H,4H2,1H3,(H,11,12,16)/t5-,7-,8-,10?/m1/s1 |
| InChIKey | AQLGOEIAAMEFND-NCYAXNGYSA-N |
| XLogP | -1.24 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|