C17H29NO7 — CID 89422452
(3S)-3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-(2-hydroxyethyl)pent-4-enoic acid (PubChem CID 89422452) has the molecular formula C17H29NO7 and a molecular weight of 359.42 g/mol. Its IUPAC name is (3S)-3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-(2-hydroxyethyl)pent-4-enoic acid.
| Compound Name | (3S)-3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-(2-hydroxyethyl)pent-4-enoic acid |
|---|---|
| PubChem CID | 89422452 |
| Molecular Formula | C17H29NO7 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | (3S)-3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-(2-hydroxyethyl)pent-4-enoic acid |
| SMILES | C=C[C@@H](C(CCO)C(=O)O)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29NO7/c1-8-12(11(9-10-19)13(20)21)18(14(22)24-16(2,3)4)15(23)25-17(5,6)7/h8,11-12,19H,1,9-10H2,2-7H3,(H,20,21)/t11?,12-/m0/s1 |
| InChIKey | TYMUPNZGMHXTEF-KIYNQFGBSA-N |
| XLogP | 2.80 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|