C24H28F3N3O4 — CID 89422987
(2,2,2-trifluoroacetyl) 6-[4-[3-(diethylamino)pyrrolidin-1-yl]phenyl]-5-ethyl-2-oxo-1H-pyridine-3-carboxylate (PubChem CID 89422987) has the molecular formula C24H28F3N3O4 and a molecular weight of 479.50 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 6-[4-[3-(diethylamino)pyrrolidin-1-yl]phenyl]-5-ethyl-2-oxo-1H-pyridine-3-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 6-[4-[3-(diethylamino)pyrrolidin-1-yl]phenyl]-5-ethyl-2-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 89422987 |
| Molecular Formula | C24H28F3N3O4 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 6-[4-[3-(diethylamino)pyrrolidin-1-yl]phenyl]-5-ethyl-2-oxo-1H-pyridine-3-carboxylate |
| SMILES | CCc1cc(C(=O)OC(=O)C(F)(F)F)c(=O)[nH]c1-c1ccc(N2CCC(N(CC)CC)C2)cc1 |
| InChI | InChI=1S/C24H28F3N3O4/c1-4-15-13-19(22(32)34-23(33)24(25,26)27)21(31)28-20(15)16-7-9-17(10-8-16)30-12-11-18(14-30)29(5-2)6-3/h7-10,13,18H,4-6,11-12,14H2,1-3H3,(H,28,31) |
| InChIKey | NIYZCWBTPULTJY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|