C32H34F3N3O4 — CID 140668850
(2,2,2-trifluoroacetyl) 6-[4-[(3aR,4R,7aR)-4-(2-phenylethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]phenyl]-5-ethyl-2-oxo-1H-pyridine-3-carboxylate (PubChem CID 140668850) has the molecular formula C32H34F3N3O4 and a molecular weight of 581.64 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 6-[4-[(3aR,4R,7aR)-4-(2-phenylethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]phenyl]-5-ethyl-2-oxo-1H-pyridine-3-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 6-[4-[(3aR,4R,7aR)-4-(2-phenylethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]phenyl]-5-ethyl-2-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 140668850 |
| Molecular Formula | C32H34F3N3O4 |
| Molecular Weight | 581.64 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 6-[4-[(3aR,4R,7aR)-4-(2-phenylethylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]phenyl]-5-ethyl-2-oxo-1H-pyridine-3-carboxylate |
| SMILES | CCc1cc(C(=O)OC(=O)C(F)(F)F)c(=O)[nH]c1-c1ccc(N2C[C@@H]3CCC[C@@H](NCCc4ccccc4)[C@H]3C2)cc1 |
| InChI | InChI=1S/C32H34F3N3O4/c1-2-21-17-25(30(40)42-31(41)32(33,34)35)29(39)37-28(21)22-11-13-24(14-12-22)38-18-23-9-6-10-27(26(23)19-38)36-16-15-20-7-4-3-5-8-20/h3-5,7-8,11-14,17,23,26-27,36H,2,6,9-10,15-16,18-19H2,1H3,(H,37,39)/t23-,26-,27+/m0/s1 |
| InChIKey | GSIYIPPDTPVNTP-MSLLRLGPSA-N |
| XLogP | 5.29 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.64 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|