C20H20F3N3 — CID 89423465
4-[5-(3,4-dimethylphenyl)-4-ethyl-3-(trifluoromethyl)pyrazol-1-yl]aniline (PubChem CID 89423465) has the molecular formula C20H20F3N3 and a molecular weight of 359.40 g/mol. Its IUPAC name is 4-[5-(3,4-dimethylphenyl)-4-ethyl-3-(trifluoromethyl)pyrazol-1-yl]aniline.
| Compound Name | 4-[5-(3,4-dimethylphenyl)-4-ethyl-3-(trifluoromethyl)pyrazol-1-yl]aniline |
|---|---|
| PubChem CID | 89423465 |
| Molecular Formula | C20H20F3N3 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 4-[5-(3,4-dimethylphenyl)-4-ethyl-3-(trifluoromethyl)pyrazol-1-yl]aniline |
| SMILES | CCc1c(C(F)(F)F)nn(-c2ccc(N)cc2)c1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C20H20F3N3/c1-4-17-18(14-6-5-12(2)13(3)11-14)26(25-19(17)20(21,22)23)16-9-7-15(24)8-10-16/h5-11H,4,24H2,1-3H3 |
| InChIKey | SOKVMAGLVUSQCD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|