C18H19ClFN3O3 — CID 8942751
[(2R)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate (PubChem CID 8942751) has the molecular formula C18H19ClFN3O3 and a molecular weight of 379.82 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate.
| Compound Name | [(2R)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8942751 |
| Molecular Formula | C18H19ClFN3O3 |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | [(2R)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate |
| SMILES | Cc1nn(C)c(C)c1NC(=O)[C@@H](C)OC(=O)/C=C/c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H19ClFN3O3/c1-10-17(11(2)23(4)22-10)21-18(25)12(3)26-16(24)8-6-13-5-7-15(20)14(19)9-13/h5-9,12H,1-4H3,(H,21,25)/b8-6+/t12-/m1/s1 |
| InChIKey | OFHKXXNIAZIZOS-WAFBPQNNSA-N |
| XLogP | 3.41 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|