C19H23N3O3 — CID 8942815
[(2S)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] (E)-3-(3-methylphenyl)prop-2-enoate (PubChem CID 8942815) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] (E)-3-(3-methylphenyl)prop-2-enoate.
| Compound Name | [(2S)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] (E)-3-(3-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8942815 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | [(2S)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] (E)-3-(3-methylphenyl)prop-2-enoate |
| SMILES | Cc1cccc(/C=C/C(=O)O[C@@H](C)C(=O)Nc2c(C)nn(C)c2C)c1 |
| InChI | InChI=1S/C19H23N3O3/c1-12-7-6-8-16(11-12)9-10-17(23)25-15(4)19(24)20-18-13(2)21-22(5)14(18)3/h6-11,15H,1-5H3,(H,20,24)/b10-9+/t15-/m0/s1 |
| InChIKey | ZQLILFMFNQEAQZ-FEAKQIBJSA-N |
| XLogP | 2.93 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|