C8H11NS — CID 89427517
4a,5,8,8a-tetrahydro-2H-thiopyrano[3,2-b]pyridine (PubChem CID 89427517) has the molecular formula C8H11NS and a molecular weight of 153.25 g/mol. Its IUPAC name is 4a,5,8,8a-tetrahydro-2H-thiopyrano[3,2-b]pyridine.
| Compound Name | 4a,5,8,8a-tetrahydro-2H-thiopyrano[3,2-b]pyridine |
|---|---|
| PubChem CID | 89427517 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 4a,5,8,8a-tetrahydro-2H-thiopyrano[3,2-b]pyridine |
| SMILES | C1=CC2NC=CCC2SC1 |
| InChI | InChI=1S/C8H11NS/c1-4-8-7(9-5-1)3-2-6-10-8/h1-3,5,7-9H,4,6H2 |
| InChIKey | HWRSFNXZZNURLS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|