C14H18N2O4 — CID 89428474
[(2S)-1-(oxazinan-2-yl)-1-oxo-3-phenylpropan-2-yl] carbamate (PubChem CID 89428474) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is [(2S)-1-(oxazinan-2-yl)-1-oxo-3-phenylpropan-2-yl] carbamate.
| Compound Name | [(2S)-1-(oxazinan-2-yl)-1-oxo-3-phenylpropan-2-yl] carbamate |
|---|---|
| PubChem CID | 89428474 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | [(2S)-1-(oxazinan-2-yl)-1-oxo-3-phenylpropan-2-yl] carbamate |
| SMILES | NC(=O)O[C@@H](Cc1ccccc1)C(=O)N1CCCCO1 |
| InChI | InChI=1S/C14H18N2O4/c15-14(18)20-12(10-11-6-2-1-3-7-11)13(17)16-8-4-5-9-19-16/h1-3,6-7,12H,4-5,8-10H2,(H2,15,18)/t12-/m0/s1 |
| InChIKey | DKMHIEAAWCIYFH-LBPRGKRZSA-N |
| XLogP | 1.25 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |