C28H56N2O — CID 89428591
(Z)-2,2,3-trimethyl-N'-propyldocos-13-enehydrazide (PubChem CID 89428591) has the molecular formula C28H56N2O and a molecular weight of 436.77 g/mol. Its IUPAC name is (Z)-2,2,3-trimethyl-N'-propyldocos-13-enehydrazide.
| Compound Name | (Z)-2,2,3-trimethyl-N'-propyldocos-13-enehydrazide |
|---|---|
| PubChem CID | 89428591 |
| Molecular Formula | C28H56N2O |
| Molecular Weight | 436.77 g/mol |
| Exact Mass | 436.44 |
| IUPAC Name | (Z)-2,2,3-trimethyl-N'-propyldocos-13-enehydrazide |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(C)C(C)(C)C(=O)NNCCC |
| InChI | InChI=1S/C28H56N2O/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-26(3)28(4,5)27(31)30-29-25-7-2/h14-15,26,29H,6-13,16-25H2,1-5H3,(H,30,31)/b15-14- |
| InChIKey | XRXKKVHOZCRWEU-PFONDFGASA-N |
| XLogP | 8.50 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.77 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|