C29H57NO2 — CID 88957916
2,2-dimethyl-N-[(Z)-11-(3-methylpentan-3-yloxy)heptadec-8-enyl]butanamide (PubChem CID 88957916) has the molecular formula C29H57NO2 and a molecular weight of 451.78 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(Z)-11-(3-methylpentan-3-yloxy)heptadec-8-enyl]butanamide.
| Compound Name | 2,2-dimethyl-N-[(Z)-11-(3-methylpentan-3-yloxy)heptadec-8-enyl]butanamide |
|---|---|
| PubChem CID | 88957916 |
| Molecular Formula | C29H57NO2 |
| Molecular Weight | 451.78 g/mol |
| Exact Mass | 451.44 |
| IUPAC Name | 2,2-dimethyl-N-[(Z)-11-(3-methylpentan-3-yloxy)heptadec-8-enyl]butanamide |
| SMILES | CCCCCCC(C/C=C\CCCCCCCNC(=O)C(C)(C)CC)OC(C)(CC)CC |
| InChI | InChI=1S/C29H57NO2/c1-8-12-13-20-23-26(32-29(7,10-3)11-4)24-21-18-16-14-15-17-19-22-25-30-27(31)28(5,6)9-2/h18,21,26H,8-17,19-20,22-25H2,1-7H3,(H,30,31)/b21-18- |
| InChIKey | FHOSHBPZBFFAAO-UZYVYHOESA-N |
| XLogP | 8.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.78 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|