C8H14N2 — CID 89431622
(4aR)-1,2,3,4,4a,5,8,8a-octahydroquinoxaline (PubChem CID 89431622) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (4aR)-1,2,3,4,4a,5,8,8a-octahydroquinoxaline.
| Compound Name | (4aR)-1,2,3,4,4a,5,8,8a-octahydroquinoxaline |
|---|---|
| PubChem CID | 89431622 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (4aR)-1,2,3,4,4a,5,8,8a-octahydroquinoxaline |
| SMILES | C1=CC[C@H]2NCCNC2C1 |
| InChI | InChI=1S/C8H14N2/c1-2-4-8-7(3-1)9-5-6-10-8/h1-2,7-10H,3-6H2/t7-,8?/m1/s1 |
| InChIKey | RLINPJZPPJRFNZ-GVHYBUMESA-N |
| XLogP | 0.27 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|